C13H11F3N2S — CID 1484823
1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole (PubChem CID 1484823) has the molecular formula C13H11F3N2S and a molecular weight of 284.31 g/mol. Its IUPAC name is 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole.
| Compound Name | 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole |
|---|---|
| PubChem CID | 1484823 |
| Molecular Formula | C13H11F3N2S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole |
| SMILES | FC(F)=C(F)CCSc1nccn1-c1ccccc1 |
| InChI | InChI=1S/C13H11F3N2S/c14-11(12(15)16)6-9-19-13-17-7-8-18(13)10-4-2-1-3-5-10/h1-5,7-8H,6,9H2 |
| InChIKey | UNLDWRSSSOWMKS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |