About 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole
1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole (PubChem CID 1484823) has the molecular formula C13H11F3N2S
and a molecular weight of 284.31 g/mol. Its IUPAC name is 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole.
Molecular Properties
| Compound Name | 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole |
| PubChem CID | 1484823 |
| Molecular Formula | C13H11F3N2S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole |
| SMILES | FC(F)=C(F)CCSc1nccn1-c1ccccc1 |
| InChI | InChI=1S/C13H11F3N2S/c14-11(12(15)16)6-9-19-13-17-7-8-18(13)10-4-2-1-3-5-10/h1-5,7-8H,6,9H2 |
| InChIKey | UNLDWRSSSOWMKS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole?
The IUPAC name of 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole (CID 1484823) is 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole.
What is the SMILES notation for 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole?
The canonical SMILES for 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole is FC(F)=C(F)CCSc1nccn1-c1ccccc1.
What is the InChIKey of 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole?
The InChIKey is UNLDWRSSSOWMKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2S/c14-11(12(15)16)6-9-19-13-17-7-8-18(13)10-4-2-1-3-5-10/h1-5,7-8H,6,9H2.
What are the key properties of 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole?
1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole has a molecular weight of 284.31 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)imidazole is sourced from PubChem (CID 1484823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).