C13H14N2O2S — CID 5233179
4-(1-phenylimidazol-2-yl)sulfanylbutanoic acid (PubChem CID 5233179) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-(1-phenylimidazol-2-yl)sulfanylbutanoic acid.
| Compound Name | 4-(1-phenylimidazol-2-yl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 5233179 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-(1-phenylimidazol-2-yl)sulfanylbutanoic acid |
| SMILES | O=C(O)CCCSc1nccn1-c1ccccc1 |
| InChI | InChI=1S/C13H14N2O2S/c16-12(17)7-4-10-18-13-14-8-9-15(13)11-5-2-1-3-6-11/h1-3,5-6,8-9H,4,7,10H2,(H,16,17) |
| InChIKey | FCUPONCNIOMGGE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|