C12H12N2O2S2 — CID 29063549
2-[1-(4-methylsulfanylphenyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 29063549) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[1-(4-methylsulfanylphenyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(4-methylsulfanylphenyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 29063549 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-[1-(4-methylsulfanylphenyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | CSc1ccc(-n2ccnc2SCC(=O)O)cc1 |
| InChI | InChI=1S/C12H12N2O2S2/c1-17-10-4-2-9(3-5-10)14-7-6-13-12(14)18-8-11(15)16/h2-7H,8H2,1H3,(H,15,16) |
| InChIKey | YLRONKBASCBURD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |