C13H8N4O2S — CID 107791452
2-[1-(3,4-dicyanophenyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 107791452) has the molecular formula C13H8N4O2S and a molecular weight of 284.30 g/mol. Its IUPAC name is 2-[1-(3,4-dicyanophenyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(3,4-dicyanophenyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 107791452 |
| Molecular Formula | C13H8N4O2S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-[1-(3,4-dicyanophenyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | N#Cc1ccc(-n2ccnc2SCC(=O)O)cc1C#N |
| InChI | InChI=1S/C13H8N4O2S/c14-6-9-1-2-11(5-10(9)7-15)17-4-3-16-13(17)20-8-12(18)19/h1-5H,8H2,(H,18,19) |
| InChIKey | OVSIKXRFQJVHMJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |