C24H23N5OS — CID 33297267
2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[1-(3,4-dimethylphenyl)imidazol-2-yl]sulfanyl-3-oxobutanenitrile (PubChem CID 33297267) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[1-(3,4-dimethylphenyl)imidazol-2-yl]sulfanyl-3-oxobutanenitrile.
| Compound Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[1-(3,4-dimethylphenyl)imidazol-2-yl]sulfanyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 33297267 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[1-(3,4-dimethylphenyl)imidazol-2-yl]sulfanyl-3-oxobutanenitrile |
| SMILES | Cc1ccc(-n2ccnc2SCC(=O)C(C#N)=C2N(C)c3ccccc3N2C)cc1C |
| InChI | InChI=1S/C24H23N5OS/c1-16-9-10-18(13-17(16)2)29-12-11-26-24(29)31-15-22(30)19(14-25)23-27(3)20-7-5-6-8-21(20)28(23)4/h5-13H,15H2,1-4H3 |
| InChIKey | UIDKNUUCINPBOG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|