C19H16BrN3OS — CID 24670763
4-(4-bromophenyl)sulfanyl-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile (PubChem CID 24670763) has the molecular formula C19H16BrN3OS and a molecular weight of 414.33 g/mol. Its IUPAC name is 4-(4-bromophenyl)sulfanyl-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile.
| Compound Name | 4-(4-bromophenyl)sulfanyl-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 24670763 |
| Molecular Formula | C19H16BrN3OS |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 4-(4-bromophenyl)sulfanyl-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
| SMILES | CN1C(=C(C#N)C(=O)CSc2ccc(Br)cc2)N(C)c2ccccc21 |
| InChI | InChI=1S/C19H16BrN3OS/c1-22-16-5-3-4-6-17(16)23(2)19(22)15(11-21)18(24)12-25-14-9-7-13(20)8-10-14/h3-10H,12H2,1-2H3 |
| InChIKey | SFBUCNOJUVTEIB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|