C22H28N4O4 — CID 56548031
ethyl 2-[[5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxopentanoyl]-propan-2-ylamino]acetate (PubChem CID 56548031) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is ethyl 2-[[5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxopentanoyl]-propan-2-ylamino]acetate.
| Compound Name | ethyl 2-[[5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxopentanoyl]-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 56548031 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | ethyl 2-[[5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxopentanoyl]-propan-2-ylamino]acetate |
| SMILES | CCOC(=O)CN(C(=O)CCC(=O)C(C#N)=C1N(C)c2ccccc2N1C)C(C)C |
| InChI | InChI=1S/C22H28N4O4/c1-6-30-21(29)14-26(15(2)3)20(28)12-11-19(27)16(13-23)22-24(4)17-9-7-8-10-18(17)25(22)5/h7-10,15H,6,11-12,14H2,1-5H3 |
| InChIKey | BYEVKKTXKSUGRP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|