C27H33N5O2 — CID 55820719
5-cyano-N-[2-(diethylamino)-2-phenylethyl]-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxopentanamide (PubChem CID 55820719) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 5-cyano-N-[2-(diethylamino)-2-phenylethyl]-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxopentanamide.
| Compound Name | 5-cyano-N-[2-(diethylamino)-2-phenylethyl]-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxopentanamide |
|---|---|
| PubChem CID | 55820719 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 5-cyano-N-[2-(diethylamino)-2-phenylethyl]-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxopentanamide |
| SMILES | CCN(CC)C(CNC(=O)CCC(=O)C(C#N)=C1N(C)c2ccccc2N1C)c1ccccc1 |
| InChI | InChI=1S/C27H33N5O2/c1-5-32(6-2)24(20-12-8-7-9-13-20)19-29-26(34)17-16-25(33)21(18-28)27-30(3)22-14-10-11-15-23(22)31(27)4/h7-15,24H,5-6,16-17,19H2,1-4H3,(H,29,34) |
| InChIKey | QOCPMWPZZRMXOR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|