C23H27N5O3 — CID 55819694
6-[4-(cyclopropanecarbonyl)piperazin-1-yl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3,6-dioxohexanenitrile (PubChem CID 55819694) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 6-[4-(cyclopropanecarbonyl)piperazin-1-yl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3,6-dioxohexanenitrile.
| Compound Name | 6-[4-(cyclopropanecarbonyl)piperazin-1-yl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3,6-dioxohexanenitrile |
|---|---|
| PubChem CID | 55819694 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 6-[4-(cyclopropanecarbonyl)piperazin-1-yl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3,6-dioxohexanenitrile |
| SMILES | CN1C(=C(C#N)C(=O)CCC(=O)N2CCN(C(=O)C3CC3)CC2)N(C)c2ccccc21 |
| InChI | InChI=1S/C23H27N5O3/c1-25-18-5-3-4-6-19(18)26(2)22(25)17(15-24)20(29)9-10-21(30)27-11-13-28(14-12-27)23(31)16-7-8-16/h3-6,16H,7-14H2,1-2H3 |
| InChIKey | DVWYKOOZGGTPLX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 87.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|