C17H20N4O2 — CID 51091565
5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-ethyl-4-oxopentanamide (PubChem CID 51091565) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-ethyl-4-oxopentanamide.
| Compound Name | 5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-ethyl-4-oxopentanamide |
|---|---|
| PubChem CID | 51091565 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-ethyl-4-oxopentanamide |
| SMILES | CCNC(=O)CCC(=O)C(C#N)=C1N(C)c2ccccc2N1C |
| InChI | InChI=1S/C17H20N4O2/c1-4-19-16(23)10-9-15(22)12(11-18)17-20(2)13-7-5-6-8-14(13)21(17)3/h5-8H,4,9-10H2,1-3H3,(H,19,23) |
| InChIKey | ZASXPJNCZDSLPH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|