C24H23N5O2S — CID 30760731
2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxo-4-(4-oxo-3-propylquinazolin-2-yl)sulfanylbutanenitrile (PubChem CID 30760731) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is 2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxo-4-(4-oxo-3-propylquinazolin-2-yl)sulfanylbutanenitrile.
| Compound Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxo-4-(4-oxo-3-propylquinazolin-2-yl)sulfanylbutanenitrile |
|---|---|
| PubChem CID | 30760731 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxo-4-(4-oxo-3-propylquinazolin-2-yl)sulfanylbutanenitrile |
| SMILES | CCCn1c(SCC(=O)C(C#N)=C2N(C)c3ccccc3N2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H23N5O2S/c1-4-13-29-23(31)16-9-5-6-10-18(16)26-24(29)32-15-21(30)17(14-25)22-27(2)19-11-7-8-12-20(19)28(22)3/h5-12H,4,13,15H2,1-3H3 |
| InChIKey | QZOBMTUCXPJUBH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 82.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|