C24H24N6OS — CID 78804946
2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile (PubChem CID 78804946) has the molecular formula C24H24N6OS and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile.
| Compound Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 78804946 |
| Molecular Formula | C24H24N6OS |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2-(1,3-dimethylbenzimidazol-2-ylidene)-4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile |
| SMILES | CCn1c(SCC(=O)C(C#N)=C2N(C)c3ccccc3N2C)nnc1-c1cccc(C)c1 |
| InChI | InChI=1S/C24H24N6OS/c1-5-30-22(17-10-8-9-16(2)13-17)26-27-24(30)32-15-21(31)18(14-25)23-28(3)19-11-6-7-12-20(19)29(23)4/h6-13H,5,15H2,1-4H3 |
| InChIKey | ZWYDFMZBNNNIIA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|