C18H21N7OS — CID 46639136
4-(1-tert-butyltetrazol-5-yl)sulfanyl-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile (PubChem CID 46639136) has the molecular formula C18H21N7OS and a molecular weight of 383.48 g/mol. Its IUPAC name is 4-(1-tert-butyltetrazol-5-yl)sulfanyl-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile.
| Compound Name | 4-(1-tert-butyltetrazol-5-yl)sulfanyl-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 46639136 |
| Molecular Formula | C18H21N7OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-(1-tert-butyltetrazol-5-yl)sulfanyl-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
| SMILES | CN1C(=C(C#N)C(=O)CSc2nnnn2C(C)(C)C)N(C)c2ccccc21 |
| InChI | InChI=1S/C18H21N7OS/c1-18(2,3)25-17(20-21-22-25)27-11-15(26)12(10-19)16-23(4)13-8-6-7-9-14(13)24(16)5/h6-9H,11H2,1-5H3 |
| InChIKey | APZRCISRNGOXHU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|