C11H10N2OS — CID 1485005
1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanone (PubChem CID 1485005) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 1485005 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 1-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)ethanone |
| SMILES | CC(=O)c1sc(-c2cccnc2)nc1C |
| InChI | InChI=1S/C11H10N2OS/c1-7-10(8(2)14)15-11(13-7)9-4-3-5-12-6-9/h3-6H,1-2H3 |
| InChIKey | NWSRUSOSLHVWOZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |