C6H12N2O — CID 148501677
N',3-dimethylbut-2-enehydrazide (PubChem CID 148501677) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is N',3-dimethylbut-2-enehydrazide.
| Compound Name | N',3-dimethylbut-2-enehydrazide |
|---|---|
| PubChem CID | 148501677 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | N',3-dimethylbut-2-enehydrazide |
| SMILES | CNNC(=O)C=C(C)C |
| InChI | InChI=1S/C6H12N2O/c1-5(2)4-6(9)8-7-3/h4,7H,1-3H3,(H,8,9) |
| InChIKey | NKHWJFZIBQDTCM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|