C19H22N4 — CID 148506480
4-N-cyclohexyl-7-(2H-pyrrol-3-yl)quinoline-2,4-diamine (PubChem CID 148506480) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-N-cyclohexyl-7-(2H-pyrrol-3-yl)quinoline-2,4-diamine.
| Compound Name | 4-N-cyclohexyl-7-(2H-pyrrol-3-yl)quinoline-2,4-diamine |
|---|---|
| PubChem CID | 148506480 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 4-N-cyclohexyl-7-(2H-pyrrol-3-yl)quinoline-2,4-diamine |
| SMILES | Nc1cc(NC2CCCCC2)c2ccc(C3=CC=NC3)cc2n1 |
| InChI | InChI=1S/C19H22N4/c20-19-11-18(22-15-4-2-1-3-5-15)16-7-6-13(10-17(16)23-19)14-8-9-21-12-14/h6-11,15H,1-5,12H2,(H3,20,22,23) |
| InChIKey | MLRFPZIZZXVLOA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |