C16H18N6 — CID 154649480
4-N-cyclopentyl-7-(1H-pyrazol-5-yl)-1,8-naphthyridine-2,4-diamine (PubChem CID 154649480) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-N-cyclopentyl-7-(1H-pyrazol-5-yl)-1,8-naphthyridine-2,4-diamine.
| Compound Name | 4-N-cyclopentyl-7-(1H-pyrazol-5-yl)-1,8-naphthyridine-2,4-diamine |
|---|---|
| PubChem CID | 154649480 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-N-cyclopentyl-7-(1H-pyrazol-5-yl)-1,8-naphthyridine-2,4-diamine |
| SMILES | Nc1cc(NC2CCCC2)c2ccc(-c3ccn[nH]3)nc2n1 |
| InChI | InChI=1S/C16H18N6/c17-15-9-14(19-10-3-1-2-4-10)11-5-6-12(20-16(11)21-15)13-7-8-18-22-13/h5-10H,1-4H2,(H,18,22)(H3,17,19,20,21) |
| InChIKey | FUQDALABDQYUGD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |