About 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine
3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine (PubChem CID 148522129) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine.
Analyze 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine?
The IUPAC name of 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine (CID 148522129) is 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine.
What is the SMILES notation for 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine?
The canonical SMILES for 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine is CC12CC3CC4(N)CC(C)(C1)C324.
What is the InChIKey of 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine?
The InChIKey is MOPTUOCUUZSLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-8-3-7-4-10(12)6-9(2,5-8)11(7,8)10/h7H,3-6,12H2,1-2H3.
What are the key properties of 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine?
3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine has a molecular weight of 163.26 g/mol, XLogP of 1.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyltetracyclo[3.3.1.03,9.07,9]nonan-1-amine is sourced from PubChem (CID 148522129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).