C22H28F3N3O — CID 148529034
4-[ethyl(methyl)amino]-1-[1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-4-yl]butan-1-one (PubChem CID 148529034) has the molecular formula C22H28F3N3O and a molecular weight of 407.48 g/mol. Its IUPAC name is 4-[ethyl(methyl)amino]-1-[1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-4-yl]butan-1-one.
| Compound Name | 4-[ethyl(methyl)amino]-1-[1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 148529034 |
| Molecular Formula | C22H28F3N3O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 4-[ethyl(methyl)amino]-1-[1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-4-yl]butan-1-one |
| SMILES | CCN(C)CCCC(=O)C1CCN(c2ccc(C(F)(F)F)c3ncccc23)CC1 |
| InChI | InChI=1S/C22H28F3N3O/c1-3-27(2)13-5-7-20(29)16-10-14-28(15-11-16)19-9-8-18(22(23,24)25)21-17(19)6-4-12-26-21/h4,6,8-9,12,16H,3,5,7,10-11,13-15H2,1-2H3 |
| InChIKey | MPXLNRMHPQXTCZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |