C28H37N3O4 — CID 148545770
2,6,6-trimethyl-4-[5-[2-(5-methyl-1H-imidazol-2-yl)-2-oxoethyl]-6-(2,5,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]oxane-2-carboxylic acid (PubChem CID 148545770) has the molecular formula C28H37N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is 2,6,6-trimethyl-4-[5-[2-(5-methyl-1H-imidazol-2-yl)-2-oxoethyl]-6-(2,5,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]oxane-2-carboxylic acid.
| Compound Name | 2,6,6-trimethyl-4-[5-[2-(5-methyl-1H-imidazol-2-yl)-2-oxoethyl]-6-(2,5,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 148545770 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 2,6,6-trimethyl-4-[5-[2-(5-methyl-1H-imidazol-2-yl)-2-oxoethyl]-6-(2,5,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]oxane-2-carboxylic acid |
| SMILES | [2H]C1=C(c2nc(C3CC(C)(C)OC(C)(C(=O)O)C3)ccc2CC(=O)c2ncc(C)[nH]2)C([2H])([2H])C([2H])C(C)(C)C1 |
| InChI | InChI=1S/C28H37N3O4/c1-17-16-29-24(30-17)22(32)13-19-7-8-21(31-23(19)18-9-11-26(2,3)12-10-18)20-14-27(4,5)35-28(6,15-20)25(33)34/h7-9,16,20H,10-15H2,1-6H3,(H,29,30)(H,33,34)/i9D,10D2,12D |
| InChIKey | MTBHCLMPVRTBMQ-OZNXSFNYSA-N |
| XLogP | 5.65 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |