C24H10Cl2O4 — CID 148551813
8,24-dichloro-3,19-dioxahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),4(9),5,7,12,14,16,20(25),21,23-undecaene-10,26-dione (PubChem CID 148551813) has the molecular formula C24H10Cl2O4 and a molecular weight of 433.25 g/mol. Its IUPAC name is 8,24-dichloro-3,19-dioxahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),4(9),5,7,12,14,16,20(25),21,23-undecaene-10,26-dione.
| Compound Name | 8,24-dichloro-3,19-dioxahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),4(9),5,7,12,14,16,20(25),21,23-undecaene-10,26-dione |
|---|---|
| PubChem CID | 148551813 |
| Molecular Formula | C24H10Cl2O4 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 8,24-dichloro-3,19-dioxahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),4(9),5,7,12,14,16,20(25),21,23-undecaene-10,26-dione |
| SMILES | O=c1c2c(Cl)cccc2oc2c1c1ccccc1c1oc3cccc(Cl)c3c(=O)c12 |
| InChI | InChI=1S/C24H10Cl2O4/c25-13-7-4-10-16-18(13)21(27)17-11-5-1-2-6-12(11)23-20(24(17)30-16)22(28)19-14(26)8-3-9-15(19)29-23/h1-10H |
| InChIKey | MTHKUXLZCWJZFY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|