C23H20FN3O — CID 148560025
(4S)-1-[3-(2-fluoro-4-pyridinyl)-1H-pyrrolo[3,4-c]pyridin-6-yl]-4-phenylpentan-2-one (PubChem CID 148560025) has the molecular formula C23H20FN3O and a molecular weight of 373.43 g/mol. Its IUPAC name is (4S)-1-[3-(2-fluoro-4-pyridinyl)-1H-pyrrolo[3,4-c]pyridin-6-yl]-4-phenylpentan-2-one.
| Compound Name | (4S)-1-[3-(2-fluoro-4-pyridinyl)-1H-pyrrolo[3,4-c]pyridin-6-yl]-4-phenylpentan-2-one |
|---|---|
| PubChem CID | 148560025 |
| Molecular Formula | C23H20FN3O |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (4S)-1-[3-(2-fluoro-4-pyridinyl)-1H-pyrrolo[3,4-c]pyridin-6-yl]-4-phenylpentan-2-one |
| SMILES | C[C@@H](CC(=O)Cc1cc2c(cn1)C(c1ccnc(F)c1)=NC2)c1ccccc1 |
| InChI | InChI=1S/C23H20FN3O/c1-15(16-5-3-2-4-6-16)9-20(28)12-19-10-18-13-27-23(21(18)14-26-19)17-7-8-25-22(24)11-17/h2-8,10-11,14-15H,9,12-13H2,1H3/t15-/m0/s1 |
| InChIKey | MUUWDPRRADOEDF-HNNXBMFYSA-N |
| XLogP | 4.27 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|