C23H26N2O — CID 161007273
(4S)-1-(3-cyclopentyl-1H-pyrrolo[3,4-c]pyridin-6-yl)-4-phenylpentan-2-one (PubChem CID 161007273) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is (4S)-1-(3-cyclopentyl-1H-pyrrolo[3,4-c]pyridin-6-yl)-4-phenylpentan-2-one.
| Compound Name | (4S)-1-(3-cyclopentyl-1H-pyrrolo[3,4-c]pyridin-6-yl)-4-phenylpentan-2-one |
|---|---|
| PubChem CID | 161007273 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (4S)-1-(3-cyclopentyl-1H-pyrrolo[3,4-c]pyridin-6-yl)-4-phenylpentan-2-one |
| SMILES | C[C@@H](CC(=O)Cc1cc2c(cn1)C(C1CCCC1)=NC2)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O/c1-16(17-7-3-2-4-8-17)11-21(26)13-20-12-19-14-25-23(22(19)15-24-20)18-9-5-6-10-18/h2-4,7-8,12,15-16,18H,5-6,9-11,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | TWQYSBGZDLAPLV-INIZCTEOSA-N |
| XLogP | 4.88 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |