C22H19F4N9 — CID 148565372
7-[1-(2-fluorophenyl)imino-2-hydrazinylidenepentan-3-yl]-5-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 148565372) has the molecular formula C22H19F4N9 and a molecular weight of 485.45 g/mol. Its IUPAC name is 7-[1-(2-fluorophenyl)imino-2-hydrazinylidenepentan-3-yl]-5-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[1-(2-fluorophenyl)imino-2-hydrazinylidenepentan-3-yl]-5-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 148565372 |
| Molecular Formula | C22H19F4N9 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 7-[1-(2-fluorophenyl)imino-2-hydrazinylidenepentan-3-yl]-5-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCC(C(/C=N/c1ccccc1F)=NN)n1cc(-c2cnc(C(F)(F)F)nc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C22H19F4N9/c1-2-17(16(34-28)9-29-15-6-4-3-5-14(15)23)35-10-13(18-19(27)32-11-33-20(18)35)12-7-30-21(31-8-12)22(24,25)26/h3-11,17H,2,28H2,1H3,(H2,27,32,33)/b29-9+,34-16? |
| InChIKey | NVBQMGSONIMHLL-BUQXXPQUSA-N |
| XLogP | 4.30 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|