C16H17FN4O — CID 129147459
3-(4-amino-7-butan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)-5-fluorophenol (PubChem CID 129147459) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-(4-amino-7-butan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)-5-fluorophenol.
| Compound Name | 3-(4-amino-7-butan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)-5-fluorophenol |
|---|---|
| PubChem CID | 129147459 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-(4-amino-7-butan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)-5-fluorophenol |
| SMILES | CCC(C)n1cc(-c2cc(O)cc(F)c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C16H17FN4O/c1-3-9(2)21-7-13(10-4-11(17)6-12(22)5-10)14-15(18)19-8-20-16(14)21/h4-9,22H,3H2,1-2H3,(H2,18,19,20) |
| InChIKey | PGGWWPAEUQCDGV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |