C15H14F3N5 — CID 175521077
5-(4-aminophenyl)-7-(1,1,3-trifluoropropan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 175521077) has the molecular formula C15H14F3N5 and a molecular weight of 321.31 g/mol. Its IUPAC name is 5-(4-aminophenyl)-7-(1,1,3-trifluoropropan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-aminophenyl)-7-(1,1,3-trifluoropropan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 175521077 |
| Molecular Formula | C15H14F3N5 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 5-(4-aminophenyl)-7-(1,1,3-trifluoropropan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ccc(-c2cn(C(CF)C(F)F)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C15H14F3N5/c16-5-11(13(17)18)23-6-10(8-1-3-9(19)4-2-8)12-14(20)21-7-22-15(12)23/h1-4,6-7,11,13H,5,19H2,(H2,20,21,22) |
| InChIKey | QONXSFFDLJNHEK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|