C15H15ClN4S — CID 135198197
4-[4-chloro-7-(2-methylsulfanylethyl)pyrrolo[2,3-d]pyrimidin-5-yl]aniline (PubChem CID 135198197) has the molecular formula C15H15ClN4S and a molecular weight of 318.83 g/mol. Its IUPAC name is 4-[4-chloro-7-(2-methylsulfanylethyl)pyrrolo[2,3-d]pyrimidin-5-yl]aniline.
| Compound Name | 4-[4-chloro-7-(2-methylsulfanylethyl)pyrrolo[2,3-d]pyrimidin-5-yl]aniline |
|---|---|
| PubChem CID | 135198197 |
| Molecular Formula | C15H15ClN4S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-[4-chloro-7-(2-methylsulfanylethyl)pyrrolo[2,3-d]pyrimidin-5-yl]aniline |
| SMILES | CSCCn1cc(-c2ccc(N)cc2)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C15H15ClN4S/c1-21-7-6-20-8-12(10-2-4-11(17)5-3-10)13-14(16)18-9-19-15(13)20/h2-5,8-9H,6-7,17H2,1H3 |
| InChIKey | BWZMCVKVBQOGQL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|