C17H17ClN4O — CID 135198356
4-[4-chloro-7-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-5-yl]aniline (PubChem CID 135198356) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 4-[4-chloro-7-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-5-yl]aniline.
| Compound Name | 4-[4-chloro-7-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-5-yl]aniline |
|---|---|
| PubChem CID | 135198356 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-[4-chloro-7-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-5-yl]aniline |
| SMILES | Nc1ccc(-c2cn(C3CCOCC3)c3ncnc(Cl)c23)cc1 |
| InChI | InChI=1S/C17H17ClN4O/c18-16-15-14(11-1-3-12(19)4-2-11)9-22(17(15)21-10-20-16)13-5-7-23-8-6-13/h1-4,9-10,13H,5-8,19H2 |
| InChIKey | BQAXINBHBQOTPT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|