C14H12ClFN4O — CID 162356308
2-[5-(4-amino-2-fluorophenyl)-4-chloropyrrolo[2,3-d]pyrimidin-7-yl]ethanol (PubChem CID 162356308) has the molecular formula C14H12ClFN4O and a molecular weight of 306.73 g/mol. Its IUPAC name is 2-[5-(4-amino-2-fluorophenyl)-4-chloropyrrolo[2,3-d]pyrimidin-7-yl]ethanol.
| Compound Name | 2-[5-(4-amino-2-fluorophenyl)-4-chloropyrrolo[2,3-d]pyrimidin-7-yl]ethanol |
|---|---|
| PubChem CID | 162356308 |
| Molecular Formula | C14H12ClFN4O |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[5-(4-amino-2-fluorophenyl)-4-chloropyrrolo[2,3-d]pyrimidin-7-yl]ethanol |
| SMILES | Nc1ccc(-c2cn(CCO)c3ncnc(Cl)c23)c(F)c1 |
| InChI | InChI=1S/C14H12ClFN4O/c15-13-12-10(9-2-1-8(17)5-11(9)16)6-20(3-4-21)14(12)19-7-18-13/h1-2,5-7,21H,3-4,17H2 |
| InChIKey | JFOUZBAPVCUDNA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|