C20H26N6O — CID 174404763
2-[[5-(4-amino-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-3-iminohexyl]amino]ethanol (PubChem CID 174404763) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-[[5-(4-amino-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-3-iminohexyl]amino]ethanol.
| Compound Name | 2-[[5-(4-amino-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-3-iminohexyl]amino]ethanol |
|---|---|
| PubChem CID | 174404763 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-[[5-(4-amino-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-3-iminohexyl]amino]ethanol |
| SMILES | [H]/N=C(\CCNCCO)CC(C)n1cc(-c2ccccc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C20H26N6O/c1-14(11-16(21)7-8-23-9-10-27)26-12-17(15-5-3-2-4-6-15)18-19(22)24-13-25-20(18)26/h2-6,12-14,21,23,27H,7-11H2,1H3,(H2,22,24,25)/b21-16+ |
| InChIKey | QVKQDXLAZHDBKJ-LTGZKZEYSA-N |
| XLogP | 2.62 |
| TPSA | 112.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|