C51H37N5Si — CID 148569527
4-carbazol-9-yl-N,N-diphenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-amine (PubChem CID 148569527) has the molecular formula C51H37N5Si and a molecular weight of 747.98 g/mol. Its IUPAC name is 4-carbazol-9-yl-N,N-diphenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-carbazol-9-yl-N,N-diphenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 148569527 |
| Molecular Formula | C51H37N5Si |
| Molecular Weight | 747.98 g/mol |
| Exact Mass | 747.28 |
| IUPAC Name | 4-carbazol-9-yl-N,N-diphenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-amine |
| SMILES | c1ccc(N(c2ccccc2)c2nc(-c3cccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)c3)nc(-n3c4ccccc4c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C51H37N5Si/c1-6-22-39(23-7-1)55(40-24-8-2-9-25-40)50-52-49(53-51(54-50)56-47-35-18-16-33-45(47)46-34-17-19-36-48(46)56)38-21-20-32-44(37-38)57(41-26-10-3-11-27-41,42-28-12-4-13-29-42)43-30-14-5-15-31-43/h1-37H |
| InChIKey | MWPLBESLRPRSDX-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.98 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|