C15H13N5O2 — CID 14857263
N-methyl-5-oxo-N,4-diphenyltetrazole-1-carboxamide (PubChem CID 14857263) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-methyl-5-oxo-N,4-diphenyltetrazole-1-carboxamide.
| Compound Name | N-methyl-5-oxo-N,4-diphenyltetrazole-1-carboxamide |
|---|---|
| PubChem CID | 14857263 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-methyl-5-oxo-N,4-diphenyltetrazole-1-carboxamide |
| SMILES | CN(C(=O)n1nnn(-c2ccccc2)c1=O)c1ccccc1 |
| InChI | InChI=1S/C15H13N5O2/c1-18(12-8-4-2-5-9-12)14(21)20-15(22)19(16-17-20)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | LHNCKKZSAXTZDA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|