C23H15F2N5O2 — CID 58502052
4-(2,6-difluorophenyl)-N-methyl-5-oxo-N-[4-(2-phenylethynyl)phenyl]tetrazole-1-carboxamide (PubChem CID 58502052) has the molecular formula C23H15F2N5O2 and a molecular weight of 431.40 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-N-methyl-5-oxo-N-[4-(2-phenylethynyl)phenyl]tetrazole-1-carboxamide.
| Compound Name | 4-(2,6-difluorophenyl)-N-methyl-5-oxo-N-[4-(2-phenylethynyl)phenyl]tetrazole-1-carboxamide |
|---|---|
| PubChem CID | 58502052 |
| Molecular Formula | C23H15F2N5O2 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 4-(2,6-difluorophenyl)-N-methyl-5-oxo-N-[4-(2-phenylethynyl)phenyl]tetrazole-1-carboxamide |
| SMILES | CN(C(=O)n1nnn(-c2c(F)cccc2F)c1=O)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H15F2N5O2/c1-28(18-14-12-17(13-15-18)11-10-16-6-3-2-4-7-16)22(31)30-23(32)29(26-27-30)21-19(24)8-5-9-20(21)25/h2-9,12-15H,1H3 |
| InChIKey | DQRPAPCXKIOAAX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|