C18H15F3N6O3 — CID 58502419
N-(4-acetamido-2-fluorophenyl)-4-(2,6-difluorophenyl)-N-ethyl-5-oxotetrazole-1-carboxamide (PubChem CID 58502419) has the molecular formula C18H15F3N6O3 and a molecular weight of 420.35 g/mol. Its IUPAC name is N-(4-acetamido-2-fluorophenyl)-4-(2,6-difluorophenyl)-N-ethyl-5-oxotetrazole-1-carboxamide.
| Compound Name | N-(4-acetamido-2-fluorophenyl)-4-(2,6-difluorophenyl)-N-ethyl-5-oxotetrazole-1-carboxamide |
|---|---|
| PubChem CID | 58502419 |
| Molecular Formula | C18H15F3N6O3 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-(4-acetamido-2-fluorophenyl)-4-(2,6-difluorophenyl)-N-ethyl-5-oxotetrazole-1-carboxamide |
| SMILES | CCN(C(=O)n1nnn(-c2c(F)cccc2F)c1=O)c1ccc(NC(C)=O)cc1F |
| InChI | InChI=1S/C18H15F3N6O3/c1-3-25(15-8-7-11(9-14(15)21)22-10(2)28)17(29)27-18(30)26(23-24-27)16-12(19)5-4-6-13(16)20/h4-9H,3H2,1-2H3,(H,22,28) |
| InChIKey | RMHUBDMZCDWGAB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|