C19H17Cl3N5O4P — CID 129101064
dimethylphosphanyl 2-chloro-5-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate (PubChem CID 129101064) has the molecular formula C19H17Cl3N5O4P and a molecular weight of 516.71 g/mol. Its IUPAC name is dimethylphosphanyl 2-chloro-5-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate.
| Compound Name | dimethylphosphanyl 2-chloro-5-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate |
|---|---|
| PubChem CID | 129101064 |
| Molecular Formula | C19H17Cl3N5O4P |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | dimethylphosphanyl 2-chloro-5-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate |
| SMILES | CCN(C(=O)n1nnn(-c2c(Cl)cccc2Cl)c1=O)c1ccc(Cl)c(C(=O)OP(C)C)c1 |
| InChI | InChI=1S/C19H17Cl3N5O4P/c1-4-25(11-8-9-13(20)12(10-11)17(28)31-32(2)3)18(29)27-19(30)26(23-24-27)16-14(21)6-5-7-15(16)22/h5-10H,4H2,1-3H3 |
| InChIKey | JLFRRQGWRYBTCJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|