C18H15Cl2N5O4 — CID 58501976
methyl 4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate (PubChem CID 58501976) has the molecular formula C18H15Cl2N5O4 and a molecular weight of 436.26 g/mol. Its IUPAC name is methyl 4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate.
| Compound Name | methyl 4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate |
|---|---|
| PubChem CID | 58501976 |
| Molecular Formula | C18H15Cl2N5O4 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | methyl 4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate |
| SMILES | CCN(C(=O)n1nnn(-c2c(Cl)cccc2Cl)c1=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C18H15Cl2N5O4/c1-3-23(12-9-7-11(8-10-12)16(26)29-2)17(27)25-18(28)24(21-22-25)15-13(19)5-4-6-14(15)20/h4-10H,3H2,1-2H3 |
| InChIKey | KPUBYCKIWSDLIM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|