C17H15Cl2N5O3 — CID 58502301
4-(2,6-dichlorophenyl)-N-ethyl-N-(4-methoxyphenyl)-5-oxotetrazole-1-carboxamide (PubChem CID 58502301) has the molecular formula C17H15Cl2N5O3 and a molecular weight of 408.25 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-N-ethyl-N-(4-methoxyphenyl)-5-oxotetrazole-1-carboxamide.
| Compound Name | 4-(2,6-dichlorophenyl)-N-ethyl-N-(4-methoxyphenyl)-5-oxotetrazole-1-carboxamide |
|---|---|
| PubChem CID | 58502301 |
| Molecular Formula | C17H15Cl2N5O3 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-N-ethyl-N-(4-methoxyphenyl)-5-oxotetrazole-1-carboxamide |
| SMILES | CCN(C(=O)n1nnn(-c2c(Cl)cccc2Cl)c1=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H15Cl2N5O3/c1-3-22(11-7-9-12(27-2)10-8-11)16(25)24-17(26)23(20-21-24)15-13(18)5-4-6-14(15)19/h4-10H,3H2,1-2H3 |
| InChIKey | WKXJUBCPWGKFKB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|