C24H18Cl3N5O4 — CID 58502174
benzyl 2-chloro-4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate (PubChem CID 58502174) has the molecular formula C24H18Cl3N5O4 and a molecular weight of 546.80 g/mol. Its IUPAC name is benzyl 2-chloro-4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate.
| Compound Name | benzyl 2-chloro-4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate |
|---|---|
| PubChem CID | 58502174 |
| Molecular Formula | C24H18Cl3N5O4 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | benzyl 2-chloro-4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoate |
| SMILES | CCN(C(=O)n1nnn(-c2c(Cl)cccc2Cl)c1=O)c1ccc(C(=O)OCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C24H18Cl3N5O4/c1-2-30(23(34)32-24(35)31(28-29-32)21-18(25)9-6-10-19(21)26)16-11-12-17(20(27)13-16)22(33)36-14-15-7-4-3-5-8-15/h3-13H,2,14H2,1H3 |
| InChIKey | WHPJJXOKJLDSBP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|