C24H21FN5O6P — CID 129100493
benzyl 5-[[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]-phosphanylamino]-2-methoxybenzoate (PubChem CID 129100493) has the molecular formula C24H21FN5O6P and a molecular weight of 525.43 g/mol. Its IUPAC name is benzyl 5-[[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]-phosphanylamino]-2-methoxybenzoate.
| Compound Name | benzyl 5-[[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]-phosphanylamino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 129100493 |
| Molecular Formula | C24H21FN5O6P |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | benzyl 5-[[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]-phosphanylamino]-2-methoxybenzoate |
| SMILES | COc1ccc(N(P)C(=O)n2nnn(-c3c(F)cccc3OC)c2=O)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H21FN5O6P/c1-34-19-12-11-16(13-17(19)22(31)36-14-15-7-4-3-5-8-15)30(37)24(33)29-23(32)28(26-27-29)21-18(25)9-6-10-20(21)35-2/h3-13H,14,37H2,1-2H3 |
| InChIKey | PLAAUXDFXCGBIN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 117.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|