C23H28FN5O4 — CID 90076443
N-(2-butoxy-5-methylphenyl)-4-(2-fluoro-6-methoxyphenyl)-5-oxo-N-propan-2-yltetrazole-1-carboxamide (PubChem CID 90076443) has the molecular formula C23H28FN5O4 and a molecular weight of 457.51 g/mol. Its IUPAC name is N-(2-butoxy-5-methylphenyl)-4-(2-fluoro-6-methoxyphenyl)-5-oxo-N-propan-2-yltetrazole-1-carboxamide.
| Compound Name | N-(2-butoxy-5-methylphenyl)-4-(2-fluoro-6-methoxyphenyl)-5-oxo-N-propan-2-yltetrazole-1-carboxamide |
|---|---|
| PubChem CID | 90076443 |
| Molecular Formula | C23H28FN5O4 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | N-(2-butoxy-5-methylphenyl)-4-(2-fluoro-6-methoxyphenyl)-5-oxo-N-propan-2-yltetrazole-1-carboxamide |
| SMILES | CCCCOc1ccc(C)cc1N(C(=O)n1nnn(-c2c(F)cccc2OC)c1=O)C(C)C |
| InChI | InChI=1S/C23H28FN5O4/c1-6-7-13-33-19-12-11-16(4)14-18(19)27(15(2)3)22(30)29-23(31)28(25-26-29)21-17(24)9-8-10-20(21)32-5/h8-12,14-15H,6-7,13H2,1-5H3 |
| InChIKey | ODZSSVFZKNZIRW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|