C27H32FN5O8 — CID 58501933
5-[cyclohexyl-[4-[2-fluoro-6-(2-methoxyethoxy)phenyl]-5-oxotetrazole-1-carbonyl]amino]-2-(2-methoxyethoxy)benzoic acid (PubChem CID 58501933) has the molecular formula C27H32FN5O8 and a molecular weight of 573.58 g/mol. Its IUPAC name is 5-[cyclohexyl-[4-[2-fluoro-6-(2-methoxyethoxy)phenyl]-5-oxotetrazole-1-carbonyl]amino]-2-(2-methoxyethoxy)benzoic acid.
| Compound Name | 5-[cyclohexyl-[4-[2-fluoro-6-(2-methoxyethoxy)phenyl]-5-oxotetrazole-1-carbonyl]amino]-2-(2-methoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 58501933 |
| Molecular Formula | C27H32FN5O8 |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 5-[cyclohexyl-[4-[2-fluoro-6-(2-methoxyethoxy)phenyl]-5-oxotetrazole-1-carbonyl]amino]-2-(2-methoxyethoxy)benzoic acid |
| SMILES | COCCOc1ccc(N(C(=O)n2nnn(-c3c(F)cccc3OCCOC)c2=O)C2CCCCC2)cc1C(=O)O |
| InChI | InChI=1S/C27H32FN5O8/c1-38-13-15-40-22-12-11-19(17-20(22)25(34)35)31(18-7-4-3-5-8-18)26(36)33-27(37)32(29-30-33)24-21(28)9-6-10-23(24)41-16-14-39-2/h6,9-12,17-18H,3-5,7-8,13-16H2,1-2H3,(H,34,35) |
| InChIKey | OWCIZPBUGUCQGF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 147.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|