C27H25F2N5O3 — CID 58501912
N-cyclohexyl-4-(2,6-difluorophenyl)-N-(4-methyl-2-phenoxyphenyl)-5-oxotetrazole-1-carboxamide (PubChem CID 58501912) has the molecular formula C27H25F2N5O3 and a molecular weight of 505.53 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,6-difluorophenyl)-N-(4-methyl-2-phenoxyphenyl)-5-oxotetrazole-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(2,6-difluorophenyl)-N-(4-methyl-2-phenoxyphenyl)-5-oxotetrazole-1-carboxamide |
|---|---|
| PubChem CID | 58501912 |
| Molecular Formula | C27H25F2N5O3 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | N-cyclohexyl-4-(2,6-difluorophenyl)-N-(4-methyl-2-phenoxyphenyl)-5-oxotetrazole-1-carboxamide |
| SMILES | Cc1ccc(N(C(=O)n2nnn(-c3c(F)cccc3F)c2=O)C2CCCCC2)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C27H25F2N5O3/c1-18-15-16-23(24(17-18)37-20-11-6-3-7-12-20)32(19-9-4-2-5-10-19)26(35)34-27(36)33(30-31-34)25-21(28)13-8-14-22(25)29/h3,6-8,11-17,19H,2,4-5,9-10H2,1H3 |
| InChIKey | OHVDZRNKHOOBRX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|