C19H16FN5O5 — CID 58502138
3-[cyclopropyl-[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid (PubChem CID 58502138) has the molecular formula C19H16FN5O5 and a molecular weight of 413.37 g/mol. Its IUPAC name is 3-[cyclopropyl-[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid.
| Compound Name | 3-[cyclopropyl-[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 58502138 |
| Molecular Formula | C19H16FN5O5 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 3-[cyclopropyl-[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid |
| SMILES | COc1cccc(F)c1-n1nnn(C(=O)N(c2cccc(C(=O)O)c2)C2CC2)c1=O |
| InChI | InChI=1S/C19H16FN5O5/c1-30-15-7-3-6-14(20)16(15)24-19(29)25(22-21-24)18(28)23(12-8-9-12)13-5-2-4-11(10-13)17(26)27/h2-7,10,12H,8-9H2,1H3,(H,26,27) |
| InChIKey | NDSAERVKVQTRMF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|