C22H25FN6O6 — CID 88888546
N-cyclopentyl-4-(2-fluoro-6-methoxyphenyl)-N-[3-[hydroxy-(hydroxyamino)methyl]-4-methoxyphenyl]-5-oxotetrazole-1-carboxamide (PubChem CID 88888546) has the molecular formula C22H25FN6O6 and a molecular weight of 488.48 g/mol. Its IUPAC name is N-cyclopentyl-4-(2-fluoro-6-methoxyphenyl)-N-[3-[hydroxy-(hydroxyamino)methyl]-4-methoxyphenyl]-5-oxotetrazole-1-carboxamide.
| Compound Name | N-cyclopentyl-4-(2-fluoro-6-methoxyphenyl)-N-[3-[hydroxy-(hydroxyamino)methyl]-4-methoxyphenyl]-5-oxotetrazole-1-carboxamide |
|---|---|
| PubChem CID | 88888546 |
| Molecular Formula | C22H25FN6O6 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | N-cyclopentyl-4-(2-fluoro-6-methoxyphenyl)-N-[3-[hydroxy-(hydroxyamino)methyl]-4-methoxyphenyl]-5-oxotetrazole-1-carboxamide |
| SMILES | COc1ccc(N(C(=O)n2nnn(-c3c(F)cccc3OC)c2=O)C2CCCC2)cc1C(O)NO |
| InChI | InChI=1S/C22H25FN6O6/c1-34-17-11-10-14(12-15(17)20(30)24-33)27(13-6-3-4-7-13)21(31)29-22(32)28(25-26-29)19-16(23)8-5-9-18(19)35-2/h5,8-13,20,24,30,33H,3-4,6-7H2,1-2H3 |
| InChIKey | XDLBIGZQWNBYNQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 143.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|