C23H21F2N5O5 — CID 54591150
5-[cyclohexyl-[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]amino]-2,3-dihydro-1-benzofuran-7-carboxylic acid (PubChem CID 54591150) has the molecular formula C23H21F2N5O5 and a molecular weight of 485.45 g/mol. Its IUPAC name is 5-[cyclohexyl-[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]amino]-2,3-dihydro-1-benzofuran-7-carboxylic acid.
| Compound Name | 5-[cyclohexyl-[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]amino]-2,3-dihydro-1-benzofuran-7-carboxylic acid |
|---|---|
| PubChem CID | 54591150 |
| Molecular Formula | C23H21F2N5O5 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 5-[cyclohexyl-[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]amino]-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| SMILES | O=C(O)c1cc(N(C(=O)n2nnn(-c3c(F)cccc3F)c2=O)C2CCCCC2)cc2c1OCC2 |
| InChI | InChI=1S/C23H21F2N5O5/c24-17-7-4-8-18(25)19(17)29-23(34)30(27-26-29)22(33)28(14-5-2-1-3-6-14)15-11-13-9-10-35-20(13)16(12-15)21(31)32/h4,7-8,11-12,14H,1-3,5-6,9-10H2,(H,31,32) |
| InChIKey | LPYAWRJYLKUENX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|