C27H29F2N7O5 — CID 58502231
2-(4-acetylpiperazin-1-yl)-5-[cyclohexyl-[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid (PubChem CID 58502231) has the molecular formula C27H29F2N7O5 and a molecular weight of 569.57 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-yl)-5-[cyclohexyl-[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid.
| Compound Name | 2-(4-acetylpiperazin-1-yl)-5-[cyclohexyl-[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 58502231 |
| Molecular Formula | C27H29F2N7O5 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 2-(4-acetylpiperazin-1-yl)-5-[cyclohexyl-[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid |
| SMILES | CC(=O)N1CCN(c2ccc(N(C(=O)n3nnn(-c4c(F)cccc4F)c3=O)C3CCCCC3)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C27H29F2N7O5/c1-17(37)32-12-14-33(15-13-32)23-11-10-19(16-20(23)25(38)39)34(18-6-3-2-4-7-18)26(40)36-27(41)35(30-31-36)24-21(28)8-5-9-22(24)29/h5,8-11,16,18H,2-4,6-7,12-15H2,1H3,(H,38,39) |
| InChIKey | UYTMFCXRCUFPCJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|