C15H11ClO3 — CID 69167894
5-(4-chlorophenyl)-2,3-dihydro-1-benzofuran-7-carboxylic acid (PubChem CID 69167894) has the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,3-dihydro-1-benzofuran-7-carboxylic acid.
| Compound Name | 5-(4-chlorophenyl)-2,3-dihydro-1-benzofuran-7-carboxylic acid |
|---|---|
| PubChem CID | 69167894 |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 5-(4-chlorophenyl)-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(Cl)cc2)cc2c1OCC2 |
| InChI | InChI=1S/C15H11ClO3/c16-12-3-1-9(2-4-12)11-7-10-5-6-19-14(10)13(8-11)15(17)18/h1-4,7-8H,5-6H2,(H,17,18) |
| InChIKey | FKSGLWPWEMLGIK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |