C16H14O3 — CID 69166433
5-(4-methylphenyl)-2,3-dihydro-1-benzofuran-7-carboxylic acid (PubChem CID 69166433) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2,3-dihydro-1-benzofuran-7-carboxylic acid.
| Compound Name | 5-(4-methylphenyl)-2,3-dihydro-1-benzofuran-7-carboxylic acid |
|---|---|
| PubChem CID | 69166433 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-(4-methylphenyl)-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| SMILES | Cc1ccc(-c2cc3c(c(C(=O)O)c2)OCC3)cc1 |
| InChI | InChI=1S/C16H14O3/c1-10-2-4-11(5-3-10)13-8-12-6-7-19-15(12)14(9-13)16(17)18/h2-5,8-9H,6-7H2,1H3,(H,17,18) |
| InChIKey | OUENOTMODLOQNK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |