C18H16O3S — CID 151048521
[7-(4-methylbenzenecarbothioyl)-2,3-dihydro-1-benzofuran-5-yl] acetate (PubChem CID 151048521) has the molecular formula C18H16O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is [7-(4-methylbenzenecarbothioyl)-2,3-dihydro-1-benzofuran-5-yl] acetate.
| Compound Name | [7-(4-methylbenzenecarbothioyl)-2,3-dihydro-1-benzofuran-5-yl] acetate |
|---|---|
| PubChem CID | 151048521 |
| Molecular Formula | C18H16O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [7-(4-methylbenzenecarbothioyl)-2,3-dihydro-1-benzofuran-5-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c(C(=S)c3ccc(C)cc3)c1)OCC2 |
| InChI | InChI=1S/C18H16O3S/c1-11-3-5-13(6-4-11)18(22)16-10-15(21-12(2)19)9-14-7-8-20-17(14)16/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | MDPSRBDKNRPYOV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|