C20H20FN5O5S — CID 126499090
3-[butylsulfanyl-[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid (PubChem CID 126499090) has the molecular formula C20H20FN5O5S and a molecular weight of 461.48 g/mol. Its IUPAC name is 3-[butylsulfanyl-[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid.
| Compound Name | 3-[butylsulfanyl-[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 126499090 |
| Molecular Formula | C20H20FN5O5S |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 3-[butylsulfanyl-[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]benzoic acid |
| SMILES | CCCCSN(C(=O)n1nnn(-c2c(F)cccc2OC)c1=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H20FN5O5S/c1-3-4-11-32-26(14-8-5-7-13(12-14)18(27)28)20(30)25-19(29)24(22-23-25)17-15(21)9-6-10-16(17)31-2/h5-10,12H,3-4,11H2,1-2H3,(H,27,28) |
| InChIKey | BJXPVLIDEGETAC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'amidotetrazole', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|